About (2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide
(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide (PubChem CID 129434540) has the molecular formula C20H30N2O3
and a molecular weight of 346.47 g/mol. Its IUPAC name is (2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide.
Molecular Properties
| Compound Name | (2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide |
| PubChem CID | 129434540 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide |
| SMILES | C[C@H](CCNC(=O)N1CCC[C@@H]1[C@H]1COCC[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C20H30N2O3/c1-15(16-6-3-2-4-7-16)9-11-21-20(24)22-12-5-8-18(22)17-14-25-13-10-19(17)23/h2-4,6-7,15,17-19,23H,5,8-14H2,1H3,(H,21,24)/t15-,17-,18-,19+/m1/s1 |
| InChIKey | DXNMDLTYEJPUCY-OWYHZJEWSA-N |
| XLogP | 2.75 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide?
The IUPAC name of (2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide (CID 129434540) is (2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide.
What is the SMILES notation for (2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide?
The canonical SMILES for (2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide is C[C@H](CCNC(=O)N1CCC[C@@H]1[C@H]1COCC[C@@H]1O)c1ccccc1.
What is the InChIKey of (2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide?
The InChIKey is DXNMDLTYEJPUCY-OWYHZJEWSA-N. The full InChI is InChI=1S/C20H30N2O3/c1-15(16-6-3-2-4-7-16)9-11-21-20(24)22-12-5-8-18(22)17-14-25-13-10-19(17)23/h2-4,6-7,15,17-19,23H,5,8-14H2,1H3,(H,21,24)/t15-,17-,18-,19+/m1/s1.
What are the key properties of (2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide?
(2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide has a molecular weight of 346.47 g/mol, XLogP of 2.75, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3S,4S)-4-hydroxyoxan-3-yl]-N-[(3R)-3-phenylbutyl]pyrrolidine-1-carboxamide is sourced from PubChem (CID 129434540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).