C11H22F2N2O3S — CID 129434741
(2R,5S)-1-[2-(2,2-difluoroethoxy)ethyl]-2,5-dimethyl-4-methylsulfonylpiperazine (PubChem CID 129434741) has the molecular formula C11H22F2N2O3S and a molecular weight of 300.37 g/mol. Its IUPAC name is (2R,5S)-1-[2-(2,2-difluoroethoxy)ethyl]-2,5-dimethyl-4-methylsulfonylpiperazine.
| Compound Name | (2R,5S)-1-[2-(2,2-difluoroethoxy)ethyl]-2,5-dimethyl-4-methylsulfonylpiperazine |
|---|---|
| PubChem CID | 129434741 |
| Molecular Formula | C11H22F2N2O3S |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | (2R,5S)-1-[2-(2,2-difluoroethoxy)ethyl]-2,5-dimethyl-4-methylsulfonylpiperazine |
| SMILES | C[C@@H]1CN(S(C)(=O)=O)[C@@H](C)CN1CCOCC(F)F |
| InChI | InChI=1S/C11H22F2N2O3S/c1-9-7-15(19(3,16)17)10(2)6-14(9)4-5-18-8-11(12)13/h9-11H,4-8H2,1-3H3/t9-,10+/m1/s1 |
| InChIKey | UGSFSHPVKNYFKE-ZJUUUORDSA-N |
| XLogP | 0.62 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|