About (1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide
(1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide (PubChem CID 129435393) has the molecular formula C15H22FNOS
and a molecular weight of 283.41 g/mol. Its IUPAC name is (1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide.
Molecular Properties
| Compound Name | (1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide |
| PubChem CID | 129435393 |
| Molecular Formula | C15H22FNOS |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide |
| SMILES | C[C@@H](CN1CC[S@](=O)C(C)(C)C1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H22FNOS/c1-12(13-4-6-14(16)7-5-13)10-17-8-9-19(18)15(2,3)11-17/h4-7,12H,8-11H2,1-3H3/t12-,19-/m0/s1 |
| InChIKey | FCZPJWVBKKNFNG-BUXKBTBVSA-N |
| XLogP | 2.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide?
The IUPAC name of (1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide (CID 129435393) is (1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide.
What is the SMILES notation for (1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide?
The canonical SMILES for (1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide is C[C@@H](CN1CC[S@](=O)C(C)(C)C1)c1ccc(F)cc1.
What is the InChIKey of (1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide?
The InChIKey is FCZPJWVBKKNFNG-BUXKBTBVSA-N. The full InChI is InChI=1S/C15H22FNOS/c1-12(13-4-6-14(16)7-5-13)10-17-8-9-19(18)15(2,3)11-17/h4-7,12H,8-11H2,1-3H3/t12-,19-/m0/s1.
What are the key properties of (1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide?
(1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide has a molecular weight of 283.41 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-4-[(2R)-2-(4-fluorophenyl)propyl]-2,2-dimethyl-1,4-thiazinane 1-oxide is sourced from PubChem (CID 129435393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).