C30H39N3O5 — CID 129436163
(1S,2R,5R,6S,7S)-2-N-cyclohexyl-6-N-(4-methoxyphenyl)-3-[(1S,2R)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129436163) has the molecular formula C30H39N3O5 and a molecular weight of 521.66 g/mol. Its IUPAC name is (1S,2R,5R,6S,7S)-2-N-cyclohexyl-6-N-(4-methoxyphenyl)-3-[(1S,2R)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7S)-2-N-cyclohexyl-6-N-(4-methoxyphenyl)-3-[(1S,2R)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129436163 |
| Molecular Formula | C30H39N3O5 |
| Molecular Weight | 521.66 g/mol |
| Exact Mass | 521.29 |
| IUPAC Name | (1S,2R,5R,6S,7S)-2-N-cyclohexyl-6-N-(4-methoxyphenyl)-3-[(1S,2R)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2[C@@H]3C=C[C@]4(O3)[C@@H]2C(=O)N([C@H]2CCCC[C@H]2C)[C@H]4C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C30H39N3O5/c1-18-8-6-7-11-22(18)33-26(28(35)32-19-9-4-3-5-10-19)30-17-16-23(38-30)24(25(30)29(33)36)27(34)31-20-12-14-21(37-2)15-13-20/h12-19,22-26H,3-11H2,1-2H3,(H,31,34)(H,32,35)/t18-,22+,23+,24-,25+,26+,30+/m1/s1 |
| InChIKey | MHJUORDXXLYKEN-AWAWTLMJSA-N |
| XLogP | 3.81 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.66 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|