C19H18N2O2 — CID 129437656
(1R,2R,6R,7R)-4-[[(E)-3-phenylprop-2-enylidene]amino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 129437656) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is (1R,2R,6R,7R)-4-[[(E)-3-phenylprop-2-enylidene]amino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | (1R,2R,6R,7R)-4-[[(E)-3-phenylprop-2-enylidene]amino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 129437656 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | (1R,2R,6R,7R)-4-[[(E)-3-phenylprop-2-enylidene]amino]-4-azatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | O=C1[C@H]2[C@H](C(=O)N1N=C/C=C/c1ccccc1)[C@H]1C=C[C@H]2CC1 |
| InChI | InChI=1S/C19H18N2O2/c22-18-16-14-8-9-15(11-10-14)17(16)19(23)21(18)20-12-4-7-13-5-2-1-3-6-13/h1-9,12,14-17H,10-11H2/b7-4+,20-12?/t14-,15-,16+,17+/m0/s1 |
| InChIKey | AXLRTSCFEIFQHV-RLRSUPILSA-N |
| XLogP | 2.88 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|