C23H37NO4 — CID 129437775
(3S,5S,8S,9R,10S,13S,14R,17R)-17-(N-hydroxy-C-methylcarbonimidoyl)-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-12,2'-1,3-dioxolane]-3-ol (PubChem CID 129437775) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is (3S,5S,8S,9R,10S,13S,14R,17R)-17-(N-hydroxy-C-methylcarbonimidoyl)-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-12,2'-1,3-dioxolane]-3-ol.
| Compound Name | (3S,5S,8S,9R,10S,13S,14R,17R)-17-(N-hydroxy-C-methylcarbonimidoyl)-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-12,2'-1,3-dioxolane]-3-ol |
|---|---|
| PubChem CID | 129437775 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | (3S,5S,8S,9R,10S,13S,14R,17R)-17-(N-hydroxy-C-methylcarbonimidoyl)-10,13-dimethylspiro[1,2,3,4,5,6,7,8,9,11,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-12,2'-1,3-dioxolane]-3-ol |
| SMILES | CC(=NO)[C@@H]1CC[C@@H]2[C@H]3CC[C@H]4C[C@@H](O)CC[C@]4(C)[C@@H]3CC3(OCCO3)[C@@]21C |
| InChI | InChI=1S/C23H37NO4/c1-14(24-26)18-6-7-19-17-5-4-15-12-16(25)8-9-21(15,2)20(17)13-23(22(18,19)3)27-10-11-28-23/h15-20,25-26H,4-13H2,1-3H3/t15-,16-,17+,18-,19+,20+,21-,22+/m0/s1 |
| InChIKey | BOGNVRMACWQKIH-QJGYOZDHSA-N |
| XLogP | 4.21 |
| TPSA | 71.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|