C21H17O2PS2 — CID 12943895
2-(4-methoxyphenyl)-4,5-diphenyl-2-sulfanylidene-1,3,2lambda5-oxathiaphosphole (PubChem CID 12943895) has the molecular formula C21H17O2PS2 and a molecular weight of 396.47 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4,5-diphenyl-2-sulfanylidene-1,3,2lambda5-oxathiaphosphole.
| Compound Name | 2-(4-methoxyphenyl)-4,5-diphenyl-2-sulfanylidene-1,3,2lambda5-oxathiaphosphole |
|---|---|
| PubChem CID | 12943895 |
| Molecular Formula | C21H17O2PS2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-(4-methoxyphenyl)-4,5-diphenyl-2-sulfanylidene-1,3,2lambda5-oxathiaphosphole |
| SMILES | COc1ccc(P2(=S)OC(c3ccccc3)=C(c3ccccc3)S2)cc1 |
| InChI | InChI=1S/C21H17O2PS2/c1-22-18-12-14-19(15-13-18)24(25)23-20(16-8-4-2-5-9-16)21(26-24)17-10-6-3-7-11-17/h2-15H,1H3 |
| InChIKey | ALCAOZLOBVVDRT-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|