C25H33N3O2 — CID 129439531
(3R,4R)-N-[[(2S,3R,8aS)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide (PubChem CID 129439531) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is (3R,4R)-N-[[(2S,3R,8aS)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3R,4R)-N-[[(2S,3R,8aS)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 129439531 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | (3R,4R)-N-[[(2S,3R,8aS)-3,8,8-trimethyl-2,3,4,6,7,8a-hexahydro-1H-naphthalen-2-yl]methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
| SMILES | C[C@@H]1CC2=CCCC(C)(C)[C@@H]2C[C@@H]1C=NNC(=O)[C@H]1C(=O)NC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H33N3O2/c1-16-12-18-10-7-11-25(2,3)21(18)13-19(16)14-27-28-24(30)22-20(15-26-23(22)29)17-8-5-4-6-9-17/h4-6,8-10,14,16,19-22H,7,11-13,15H2,1-3H3,(H,26,29)(H,28,30)/t16-,19-,20+,21-,22-/m1/s1 |
| InChIKey | MRJRIRPLOONWPB-RECXWPGBSA-N |
| XLogP | 4.03 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|