C12H12F4O — CID 12944019
[2,3,5,6-tetrafluoro-4-(3-methylbut-2-enyl)phenyl]methanol (PubChem CID 12944019) has the molecular formula C12H12F4O and a molecular weight of 248.22 g/mol. Its IUPAC name is [2,3,5,6-tetrafluoro-4-(3-methylbut-2-enyl)phenyl]methanol.
| Compound Name | [2,3,5,6-tetrafluoro-4-(3-methylbut-2-enyl)phenyl]methanol |
|---|---|
| PubChem CID | 12944019 |
| Molecular Formula | C12H12F4O |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | [2,3,5,6-tetrafluoro-4-(3-methylbut-2-enyl)phenyl]methanol |
| SMILES | CC(C)=CCc1c(F)c(F)c(CO)c(F)c1F |
| InChI | InChI=1S/C12H12F4O/c1-6(2)3-4-7-9(13)11(15)8(5-17)12(16)10(7)14/h3,17H,4-5H2,1-2H3 |
| InChIKey | BLIAQTSZVPWPHK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|