C11H10F4O — CID 12944020
[4-[(E)-but-2-enyl]-2,3,5,6-tetrafluorophenyl]methanol (PubChem CID 12944020) has the molecular formula C11H10F4O and a molecular weight of 234.19 g/mol. Its IUPAC name is [4-[(E)-but-2-enyl]-2,3,5,6-tetrafluorophenyl]methanol.
| Compound Name | [4-[(E)-but-2-enyl]-2,3,5,6-tetrafluorophenyl]methanol |
|---|---|
| PubChem CID | 12944020 |
| Molecular Formula | C11H10F4O |
| Molecular Weight | 234.19 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | [4-[(E)-but-2-enyl]-2,3,5,6-tetrafluorophenyl]methanol |
| SMILES | C/C=C/Cc1c(F)c(F)c(CO)c(F)c1F |
| InChI | InChI=1S/C11H10F4O/c1-2-3-4-6-8(12)10(14)7(5-16)11(15)9(6)13/h2-3,16H,4-5H2,1H3/b3-2+ |
| InChIKey | PGEHCXDBHOOGAF-NSCUHMNNSA-N |
| XLogP | 2.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|