C25H21BrN2O — CID 129440795
(1S)-N-[[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-2,2-diphenylcyclopropane-1-carboxamide (PubChem CID 129440795) has the molecular formula C25H21BrN2O and a molecular weight of 445.36 g/mol. Its IUPAC name is (1S)-N-[[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-2,2-diphenylcyclopropane-1-carboxamide.
| Compound Name | (1S)-N-[[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-2,2-diphenylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 129440795 |
| Molecular Formula | C25H21BrN2O |
| Molecular Weight | 445.36 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | (1S)-N-[[(E)-2-bromo-3-phenylprop-2-enylidene]amino]-2,2-diphenylcyclopropane-1-carboxamide |
| SMILES | O=C(NN=C/C(Br)=C\c1ccccc1)[C@H]1CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H21BrN2O/c26-22(16-19-10-4-1-5-11-19)18-27-28-24(29)23-17-25(23,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-16,18,23H,17H2,(H,28,29)/b22-16+,27-18?/t23-/m1/s1 |
| InChIKey | VRFCKDWJKQTDKQ-HHGZRLGKSA-N |
| XLogP | 5.53 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.36 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|