C23H18Cl2N2O2 — CID 129440798
2-[(5S,10bR)-2-(4-methylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-4,6-dichlorophenol (PubChem CID 129440798) has the molecular formula C23H18Cl2N2O2 and a molecular weight of 425.32 g/mol. Its IUPAC name is 2-[(5S,10bR)-2-(4-methylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-4,6-dichlorophenol.
| Compound Name | 2-[(5S,10bR)-2-(4-methylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-4,6-dichlorophenol |
|---|---|
| PubChem CID | 129440798 |
| Molecular Formula | C23H18Cl2N2O2 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | 2-[(5S,10bR)-2-(4-methylphenyl)-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-5-yl]-4,6-dichlorophenol |
| SMILES | Cc1ccc(C2=NN3[C@H](C2)c2ccccc2O[C@H]3c2cc(Cl)cc(Cl)c2O)cc1 |
| InChI | InChI=1S/C23H18Cl2N2O2/c1-13-6-8-14(9-7-13)19-12-20-16-4-2-3-5-21(16)29-23(27(20)26-19)17-10-15(24)11-18(25)22(17)28/h2-11,20,23,28H,12H2,1H3/t20-,23+/m1/s1 |
| InChIKey | VSJKSWIFEPBVIV-OFNKIYASSA-N |
| XLogP | 6.25 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|