C18H16BrNO3 — CID 129440975
N-[[(2'R,3'R,6'R,7'R)-1'-bromospiro[1,3-dioxolane-2,9'-pentacyclo[4.3.0.02,5.03,8.04,7]nonane]-4'-yl]-phenylmethylidene]hydroxylamine (PubChem CID 129440975) has the molecular formula C18H16BrNO3 and a molecular weight of 374.23 g/mol. Its IUPAC name is N-[[(2'R,3'R,6'R,7'R)-1'-bromospiro[1,3-dioxolane-2,9'-pentacyclo[4.3.0.02,5.03,8.04,7]nonane]-4'-yl]-phenylmethylidene]hydroxylamine.
| Compound Name | N-[[(2'R,3'R,6'R,7'R)-1'-bromospiro[1,3-dioxolane-2,9'-pentacyclo[4.3.0.02,5.03,8.04,7]nonane]-4'-yl]-phenylmethylidene]hydroxylamine |
|---|---|
| PubChem CID | 129440975 |
| Molecular Formula | C18H16BrNO3 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | N-[[(2'R,3'R,6'R,7'R)-1'-bromospiro[1,3-dioxolane-2,9'-pentacyclo[4.3.0.02,5.03,8.04,7]nonane]-4'-yl]-phenylmethylidene]hydroxylamine |
| SMILES | ON=C(c1ccccc1)C12C3[C@H]4[C@H]1C1[C@@H]2[C@H]3C4(Br)C12OCCO2 |
| InChI | InChI=1S/C18H16BrNO3/c19-17-12-9-13(17)11-14(18(17)22-6-7-23-18)10(12)16(9,11)15(20-21)8-4-2-1-3-5-8/h1-5,9-14,21H,6-7H2/t9?,10-,11-,12-,13-,14?,16?,17?/m0/s1 |
| InChIKey | WTEAORZRLOVQJG-RXZYQYRJSA-N |
| XLogP | 2.49 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|