C26H22 — CID 129441127
(2S,4R,5R,6R,7R)-7-methyl-4,6-diphenylpentacyclo[7.4.0.02,5.04,6.05,7]trideca-1(13),9,11-triene (PubChem CID 129441127) has the molecular formula C26H22 and a molecular weight of 334.46 g/mol. Its IUPAC name is (2S,4R,5R,6R,7R)-7-methyl-4,6-diphenylpentacyclo[7.4.0.02,5.04,6.05,7]trideca-1(13),9,11-triene.
| Compound Name | (2S,4R,5R,6R,7R)-7-methyl-4,6-diphenylpentacyclo[7.4.0.02,5.04,6.05,7]trideca-1(13),9,11-triene |
|---|---|
| PubChem CID | 129441127 |
| Molecular Formula | C26H22 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | (2S,4R,5R,6R,7R)-7-methyl-4,6-diphenylpentacyclo[7.4.0.02,5.04,6.05,7]trideca-1(13),9,11-triene |
| SMILES | C[C@]12Cc3ccccc3[C@@H]3C[C@]4(c5ccccc5)[C@]1(c1ccccc1)[C@]324 |
| InChI | InChI=1S/C26H22/c1-23-16-18-10-8-9-15-21(18)22-17-24(19-11-4-2-5-12-19)25(23,26(22,23)24)20-13-6-3-7-14-20/h2-15,22H,16-17H2,1H3/t22-,23-,24-,25+,26+/m0/s1 |
| InChIKey | XTRWSMCCSMRYSQ-QWDLEPIUSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |