C38H22N4OS — CID 129442160
(7S)-5-amino-7-anthracen-9-yl-2-(anthracen-9-ylmethylidene)-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-6,8-dicarbonitrile (PubChem CID 129442160) has the molecular formula C38H22N4OS and a molecular weight of 582.69 g/mol. Its IUPAC name is (7S)-5-amino-7-anthracen-9-yl-2-(anthracen-9-ylmethylidene)-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-6,8-dicarbonitrile.
| Compound Name | (7S)-5-amino-7-anthracen-9-yl-2-(anthracen-9-ylmethylidene)-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-6,8-dicarbonitrile |
|---|---|
| PubChem CID | 129442160 |
| Molecular Formula | C38H22N4OS |
| Molecular Weight | 582.69 g/mol |
| Exact Mass | 582.15 |
| IUPAC Name | (7S)-5-amino-7-anthracen-9-yl-2-(anthracen-9-ylmethylidene)-3-oxo-7H-[1,3]thiazolo[3,2-a]pyridine-6,8-dicarbonitrile |
| SMILES | N#CC1=C(N)n2c(sc(=Cc3c4ccccc4cc4ccccc34)c2=O)=C(C#N)[C@H]1c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C38H22N4OS/c39-20-31-35(34-28-15-7-3-11-24(28)18-25-12-4-8-16-29(25)34)32(21-40)38-42(36(31)41)37(43)33(44-38)19-30-26-13-5-1-9-22(26)17-23-10-2-6-14-27(23)30/h1-19,35H,41H2/t35-/m0/s1 |
| InChIKey | FFYULGJOUHATEZ-DHUJRADRSA-N |
| XLogP | 6.47 |
| TPSA | 95.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.69 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|