C19H25NO3S — CID 12944217
5-[[4-[(1-ethylcyclohexyl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 12944217) has the molecular formula C19H25NO3S and a molecular weight of 347.48 g/mol. Its IUPAC name is 5-[[4-[(1-ethylcyclohexyl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-[[4-[(1-ethylcyclohexyl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 12944217 |
| Molecular Formula | C19H25NO3S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 5-[[4-[(1-ethylcyclohexyl)methoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | CCC1(COc2ccc(CC3SC(=O)NC3=O)cc2)CCCCC1 |
| InChI | InChI=1S/C19H25NO3S/c1-2-19(10-4-3-5-11-19)13-23-15-8-6-14(7-9-15)12-16-17(21)20-18(22)24-16/h6-9,16H,2-5,10-13H2,1H3,(H,20,21,22) |
| InChIKey | FTMCRYPADARNER-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|