C13H10N2O6 — CID 12944365
2-(2,3-dihydroxypropyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 12944365) has the molecular formula C13H10N2O6 and a molecular weight of 290.23 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-(2,3-dihydroxypropyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 12944365 |
| Molecular Formula | C13H10N2O6 |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-(2,3-dihydroxypropyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=c1[nH]c(=O)c2cc3c(=O)n(CC(O)CO)c(=O)c3cc12 |
| InChI | InChI=1S/C13H10N2O6/c16-4-5(17)3-15-12(20)8-1-6-7(2-9(8)13(15)21)11(19)14-10(6)18/h1-2,5,16-17H,3-4H2,(H,14,18,19) |
| InChIKey | UIEBIHBZGBJWGU-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 129.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |