C12H8N2O4S — CID 12944370
2-(2-sulfanylethyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 12944370) has the molecular formula C12H8N2O4S and a molecular weight of 276.27 g/mol. Its IUPAC name is 2-(2-sulfanylethyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2-(2-sulfanylethyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 12944370 |
| Molecular Formula | C12H8N2O4S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | 2-(2-sulfanylethyl)pyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | O=c1[nH]c(=O)c2cc3c(=O)n(CCS)c(=O)c3cc12 |
| InChI | InChI=1S/C12H8N2O4S/c15-9-5-3-7-8(4-6(5)10(16)13-9)12(18)14(1-2-19)11(7)17/h3-4,19H,1-2H2,(H,13,15,16) |
| InChIKey | GUZPUKPNRMIRQI-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|