C12H13FIN3O — CID 129445434
[[(1R,2R,3S,5R,6R,7S,8S,9S,10S)-6-fluoro-7-iodo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]urea (PubChem CID 129445434) has the molecular formula C12H13FIN3O and a molecular weight of 361.16 g/mol. Its IUPAC name is [[(1R,2R,3S,5R,6R,7S,8S,9S,10S)-6-fluoro-7-iodo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]urea.
| Compound Name | [[(1R,2R,3S,5R,6R,7S,8S,9S,10S)-6-fluoro-7-iodo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]urea |
|---|---|
| PubChem CID | 129445434 |
| Molecular Formula | C12H13FIN3O |
| Molecular Weight | 361.16 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | [[(1R,2R,3S,5R,6R,7S,8S,9S,10S)-6-fluoro-7-iodo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]urea |
| SMILES | NC(=O)NN=C1[C@H]2[C@H]3C[C@H]4[C@H]5[C@@H]3[C@H]1[C@](F)([C@H]42)[C@H]5I |
| InChI | InChI=1S/C12H13FIN3O/c13-12-7-3-1-2-4(5(3)10(12)14)8(12)9(6(2)7)16-17-11(15)18/h2-8,10H,1H2,(H3,15,17,18)/t2-,3-,4+,5-,6-,7+,8+,10-,12+/m0/s1 |
| InChIKey | MBGUCZDUDAPKPA-XBZXQYOISA-N |
| XLogP | 1.29 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|