C18H27NO2 — CID 129446179
4-[(3R)-3-[[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]amino]butyl]phenol (PubChem CID 129446179) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-[(3R)-3-[[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]amino]butyl]phenol.
| Compound Name | 4-[(3R)-3-[[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]amino]butyl]phenol |
|---|---|
| PubChem CID | 129446179 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 4-[(3R)-3-[[(3aS,4R,7aR)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]amino]butyl]phenol |
| SMILES | C[C@H](CCc1ccc(O)cc1)N[C@@H]1CCC[C@H]2OCC[C@@H]12 |
| InChI | InChI=1S/C18H27NO2/c1-13(5-6-14-7-9-15(20)10-8-14)19-17-3-2-4-18-16(17)11-12-21-18/h7-10,13,16-20H,2-6,11-12H2,1H3/t13-,16+,17-,18-/m1/s1 |
| InChIKey | ODDRWAQINKKTBV-BVPBIZIASA-N |
| XLogP | 3.26 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |