C20H33N3 — CID 129446341
trans-(1S,3S)-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-3-phenylcyclopentan-1-amine (PubChem CID 129446341) has the molecular formula C20H33N3 and a molecular weight of 315.50 g/mol. Its IUPAC name is trans-(1S,3S)-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-3-phenylcyclopentan-1-amine.
| Compound Name | trans-(1S,3S)-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-3-phenylcyclopentan-1-amine |
|---|---|
| PubChem CID | 129446341 |
| Molecular Formula | C20H33N3 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | trans-(1S,3S)-N-[3-(4-methyl-1,4-diazepan-1-yl)propyl]-3-phenylcyclopentan-1-amine |
| SMILES | CN1CCCN(CCCN[C@H]2CC[C@H](c3ccccc3)C2)CC1 |
| InChI | InChI=1S/C20H33N3/c1-22-12-6-14-23(16-15-22)13-5-11-21-20-10-9-19(17-20)18-7-3-2-4-8-18/h2-4,7-8,19-21H,5-6,9-17H2,1H3/t19-,20-/m0/s1 |
| InChIKey | STQRGHGRXRYHLJ-PMACEKPBSA-N |
| XLogP | 2.94 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|