C17H30N2O3S — CID 129446377
2-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl-ethylamino]-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide (PubChem CID 129446377) has the molecular formula C17H30N2O3S and a molecular weight of 342.51 g/mol. Its IUPAC name is 2-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl-ethylamino]-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide.
| Compound Name | 2-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl-ethylamino]-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
|---|---|
| PubChem CID | 129446377 |
| Molecular Formula | C17H30N2O3S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 2-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl-ethylamino]-N-[(3R)-1,1-dioxothiolan-3-yl]acetamide |
| SMILES | CCN(CC(=O)N[C@@H]1CCS(=O)(=O)C1)C[C@H]1C(C)=CCC[C@@H]1C |
| InChI | InChI=1S/C17H30N2O3S/c1-4-19(10-16-13(2)6-5-7-14(16)3)11-17(20)18-15-8-9-23(21,22)12-15/h6,14-16H,4-5,7-12H2,1-3H3,(H,18,20)/t14-,15+,16-/m0/s1 |
| InChIKey | UISCNGPLOSXQIM-XHSDSOJGSA-N |
| XLogP | 1.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|