C15H17F3N4S — CID 129446457
(2R,3R)-1-ethyl-N-(thiadiazol-4-ylmethyl)-2-(3,4,5-trifluorophenyl)pyrrolidin-3-amine (PubChem CID 129446457) has the molecular formula C15H17F3N4S and a molecular weight of 342.39 g/mol. Its IUPAC name is (2R,3R)-1-ethyl-N-(thiadiazol-4-ylmethyl)-2-(3,4,5-trifluorophenyl)pyrrolidin-3-amine.
| Compound Name | (2R,3R)-1-ethyl-N-(thiadiazol-4-ylmethyl)-2-(3,4,5-trifluorophenyl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 129446457 |
| Molecular Formula | C15H17F3N4S |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (2R,3R)-1-ethyl-N-(thiadiazol-4-ylmethyl)-2-(3,4,5-trifluorophenyl)pyrrolidin-3-amine |
| SMILES | CCN1CC[C@@H](NCc2csnn2)[C@H]1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C15H17F3N4S/c1-2-22-4-3-13(19-7-10-8-23-21-20-10)15(22)9-5-11(16)14(18)12(17)6-9/h5-6,8,13,15,19H,2-4,7H2,1H3/t13-,15-/m1/s1 |
| InChIKey | WYFIZOCEUQNUFB-UKRRQHHQSA-N |
| XLogP | 2.88 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|