C25H33N3O4 — CID 129446905
N-[[(3S,4R)-4-(3-methoxyphenyl)-1-[(2-nitrophenyl)methyl]pyrrolidin-3-yl]methyl]-N-(2-methylpropyl)acetamide (PubChem CID 129446905) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[[(3S,4R)-4-(3-methoxyphenyl)-1-[(2-nitrophenyl)methyl]pyrrolidin-3-yl]methyl]-N-(2-methylpropyl)acetamide.
| Compound Name | N-[[(3S,4R)-4-(3-methoxyphenyl)-1-[(2-nitrophenyl)methyl]pyrrolidin-3-yl]methyl]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 129446905 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | N-[[(3S,4R)-4-(3-methoxyphenyl)-1-[(2-nitrophenyl)methyl]pyrrolidin-3-yl]methyl]-N-(2-methylpropyl)acetamide |
| SMILES | COc1cccc([C@@H]2CN(Cc3ccccc3[N+](=O)[O-])C[C@H]2CN(CC(C)C)C(C)=O)c1 |
| InChI | InChI=1S/C25H33N3O4/c1-18(2)13-27(19(3)29)16-22-15-26(14-21-8-5-6-11-25(21)28(30)31)17-24(22)20-9-7-10-23(12-20)32-4/h5-12,18,22,24H,13-17H2,1-4H3/t22-,24-/m0/s1 |
| InChIKey | CNLJHQDOHPCXDM-UPVQGACJSA-N |
| XLogP | 4.32 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|