C16H23FN2O3 — CID 129447287
N-(2-ethoxyethyl)-2-[(2S,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]acetamide (PubChem CID 129447287) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2-[(2S,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]acetamide.
| Compound Name | N-(2-ethoxyethyl)-2-[(2S,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 129447287 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-(2-ethoxyethyl)-2-[(2S,4R)-2-(3-fluorophenyl)-4-hydroxypyrrolidin-1-yl]acetamide |
| SMILES | CCOCCNC(=O)CN1C[C@H](O)C[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C16H23FN2O3/c1-2-22-7-6-18-16(21)11-19-10-14(20)9-15(19)12-4-3-5-13(17)8-12/h3-5,8,14-15,20H,2,6-7,9-11H2,1H3,(H,18,21)/t14-,15+/m1/s1 |
| InChIKey | FNXFELYTYCKSGS-CABCVRRESA-N |
| XLogP | 1.09 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|