C19H32N4O2 — CID 129448698
(2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-methyl-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]butanamide (PubChem CID 129448698) has the molecular formula C19H32N4O2 and a molecular weight of 348.49 g/mol. Its IUPAC name is (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-methyl-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]butanamide.
| Compound Name | (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-methyl-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]butanamide |
|---|---|
| PubChem CID | 129448698 |
| Molecular Formula | C19H32N4O2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (2S)-2-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-3-methyl-N-[(6S)-2-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-6-yl]butanamide |
| SMILES | Cc1cn2c(n1)CC[C@H](NC(=O)[C@H](C(C)C)N1C[C@H](C)O[C@@H](C)C1)C2 |
| InChI | InChI=1S/C19H32N4O2/c1-12(2)18(23-9-14(4)25-15(5)10-23)19(24)21-16-6-7-17-20-13(3)8-22(17)11-16/h8,12,14-16,18H,6-7,9-11H2,1-5H3,(H,21,24)/t14-,15-,16-,18-/m0/s1 |
| InChIKey | UUNYBGVMCLZBRK-OVWQWFNUSA-N |
| XLogP | 1.76 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |