C22H26N2O3 — CID 129449640
(Z)-1-[4-(3-methoxyphenyl)piperazin-1-yl]-3-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-en-1-one (PubChem CID 129449640) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is (Z)-1-[4-(3-methoxyphenyl)piperazin-1-yl]-3-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-en-1-one.
| Compound Name | (Z)-1-[4-(3-methoxyphenyl)piperazin-1-yl]-3-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 129449640 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (Z)-1-[4-(3-methoxyphenyl)piperazin-1-yl]-3-[5-[(1R,2R)-2-methylcyclopropyl]furan-2-yl]prop-2-en-1-one |
| SMILES | COc1cccc(N2CCN(C(=O)/C=C\c3ccc([C@@H]4C[C@H]4C)o3)CC2)c1 |
| InChI | InChI=1S/C22H26N2O3/c1-16-14-20(16)21-8-6-18(27-21)7-9-22(25)24-12-10-23(11-13-24)17-4-3-5-19(15-17)26-2/h3-9,15-16,20H,10-14H2,1-2H3/b9-7-/t16-,20-/m1/s1 |
| InChIKey | DQHOAZKSQLBPTC-VRCOPLIQSA-N |
| XLogP | 3.77 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|