C8H14N2O — CID 129449822
(1R,4S,6S)-1,2,4,6-tetramethyl-2,5-diazabicyclo[2.2.0]hexan-3-one (PubChem CID 129449822) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is (1R,4S,6S)-1,2,4,6-tetramethyl-2,5-diazabicyclo[2.2.0]hexan-3-one.
| Compound Name | (1R,4S,6S)-1,2,4,6-tetramethyl-2,5-diazabicyclo[2.2.0]hexan-3-one |
|---|---|
| PubChem CID | 129449822 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (1R,4S,6S)-1,2,4,6-tetramethyl-2,5-diazabicyclo[2.2.0]hexan-3-one |
| SMILES | C[C@@H]1N[C@]2(C)C(=O)N(C)[C@]12C |
| InChI | InChI=1S/C8H14N2O/c1-5-8(3)7(2,9-5)6(11)10(8)4/h5,9H,1-4H3/t5-,7+,8+/m0/s1 |
| InChIKey | DOKNWQNHVUKYBY-UIISKDMLSA-N |
| XLogP | -0.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |