C17H29N3O7S — CID 129449960
(2R)-2-[[(2R)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid (PubChem CID 129449960) has the molecular formula C17H29N3O7S and a molecular weight of 419.50 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid.
| Compound Name | (2R)-2-[[(2R)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 129449960 |
| Molecular Formula | C17H29N3O7S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | (2R)-2-[[(2R)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]-4-methylpentanoyl]amino]pentanedioic acid |
| SMILES | CSCC[C@H](NC=O)C(=O)N[C@H](CC(C)C)C(=O)N[C@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H29N3O7S/c1-10(2)8-13(20-15(24)11(18-9-21)6-7-28-3)16(25)19-12(17(26)27)4-5-14(22)23/h9-13H,4-8H2,1-3H3,(H,18,21)(H,19,25)(H,20,24)(H,22,23)(H,26,27)/t11-,12+,13+/m0/s1 |
| InChIKey | PGMPHASGNWQJQY-YNEHKIRRSA-N |
| XLogP | -0.18 |
| TPSA | 161.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|