C25H17F5N2O4 — CID 129450050
9H-fluoren-9-ylmethyl N-[(2S)-4-amino-1,4-dioxo-1-(2,3,4,5,6-pentafluorophenyl)butan-2-yl]carbamate (PubChem CID 129450050) has the molecular formula C25H17F5N2O4 and a molecular weight of 504.41 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-4-amino-1,4-dioxo-1-(2,3,4,5,6-pentafluorophenyl)butan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-4-amino-1,4-dioxo-1-(2,3,4,5,6-pentafluorophenyl)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 129450050 |
| Molecular Formula | C25H17F5N2O4 |
| Molecular Weight | 504.41 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-4-amino-1,4-dioxo-1-(2,3,4,5,6-pentafluorophenyl)butan-2-yl]carbamate |
| SMILES | NC(=O)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H17F5N2O4/c26-19-18(20(27)22(29)23(30)21(19)28)24(34)16(9-17(31)33)32-25(35)36-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10H2,(H2,31,33)(H,32,35)/t16-/m0/s1 |
| InChIKey | YMCVFDCGLBVAOI-INIZCTEOSA-N |
| XLogP | 4.35 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|