C20H20N4O3 — CID 129450532
2-(4-methoxyphenyl)-5-[(3R)-3-phenylpyrrolidin-1-yl]triazole-4-carboxylic acid (PubChem CID 129450532) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-5-[(3R)-3-phenylpyrrolidin-1-yl]triazole-4-carboxylic acid.
| Compound Name | 2-(4-methoxyphenyl)-5-[(3R)-3-phenylpyrrolidin-1-yl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 129450532 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2-(4-methoxyphenyl)-5-[(3R)-3-phenylpyrrolidin-1-yl]triazole-4-carboxylic acid |
| SMILES | COc1ccc(-n2nc(C(=O)O)c(N3CC[C@H](c4ccccc4)C3)n2)cc1 |
| InChI | InChI=1S/C20H20N4O3/c1-27-17-9-7-16(8-10-17)24-21-18(20(25)26)19(22-24)23-12-11-15(13-23)14-5-3-2-4-6-14/h2-10,15H,11-13H2,1H3,(H,25,26)/t15-/m0/s1 |
| InChIKey | OZJVMMNJWJYZLB-HNNXBMFYSA-N |
| XLogP | 2.97 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |