C7H10N2O2S — CID 129450918
2-(1-ethylpyrazol-4-yl)sulfanylacetic acid (PubChem CID 129450918) has the molecular formula C7H10N2O2S and a molecular weight of 186.24 g/mol. Its IUPAC name is 2-(1-ethylpyrazol-4-yl)sulfanylacetic acid.
| Compound Name | 2-(1-ethylpyrazol-4-yl)sulfanylacetic acid |
|---|---|
| PubChem CID | 129450918 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-(1-ethylpyrazol-4-yl)sulfanylacetic acid |
| SMILES | CCn1cc(SCC(=O)O)cn1 |
| InChI | InChI=1S/C7H10N2O2S/c1-2-9-4-6(3-8-9)12-5-7(10)11/h3-4H,2,5H2,1H3,(H,10,11) |
| InChIKey | DPVZFEKYLFKOKW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |