C10H13N3O — CID 129451191
(3R,4S)-3-amino-1,4-dimethyl-4-pyridin-4-ylazetidin-2-one (PubChem CID 129451191) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is (3R,4S)-3-amino-1,4-dimethyl-4-pyridin-4-ylazetidin-2-one.
| Compound Name | (3R,4S)-3-amino-1,4-dimethyl-4-pyridin-4-ylazetidin-2-one |
|---|---|
| PubChem CID | 129451191 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (3R,4S)-3-amino-1,4-dimethyl-4-pyridin-4-ylazetidin-2-one |
| SMILES | CN1C(=O)[C@H](N)[C@]1(C)c1ccncc1 |
| InChI | InChI=1S/C10H13N3O/c1-10(7-3-5-12-6-4-7)8(11)9(14)13(10)2/h3-6,8H,11H2,1-2H3/t8-,10-/m0/s1 |
| InChIKey | HQVLNVUSYNQIMR-WPRPVWTQSA-N |
| XLogP | 0.10 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |