C15H24N2 — CID 129452350
2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-4,5-dimethylaniline (PubChem CID 129452350) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-4,5-dimethylaniline.
| Compound Name | 2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-4,5-dimethylaniline |
|---|---|
| PubChem CID | 129452350 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-4,5-dimethylaniline |
| SMILES | Cc1cc(N)c(N2[C@H](C)CCC[C@H]2C)cc1C |
| InChI | InChI=1S/C15H24N2/c1-10-8-14(16)15(9-11(10)2)17-12(3)6-5-7-13(17)4/h8-9,12-13H,5-7,16H2,1-4H3/t12-,13-/m1/s1 |
| InChIKey | WSWPDXKSODTJHT-CHWSQXEVSA-N |
| XLogP | 3.65 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|