C16H28N2O — CID 129452842
(2R,5S,7S)-1-[(4-methylpiperazin-1-yl)methyl]adamantan-2-ol (PubChem CID 129452842) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is (2R,5S,7S)-1-[(4-methylpiperazin-1-yl)methyl]adamantan-2-ol.
| Compound Name | (2R,5S,7S)-1-[(4-methylpiperazin-1-yl)methyl]adamantan-2-ol |
|---|---|
| PubChem CID | 129452842 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | (2R,5S,7S)-1-[(4-methylpiperazin-1-yl)methyl]adamantan-2-ol |
| SMILES | CN1CCN(CC23C[C@@H]4CC(C[C@H](C4)C2)[C@H]3O)CC1 |
| InChI | InChI=1S/C16H28N2O/c1-17-2-4-18(5-3-17)11-16-9-12-6-13(10-16)8-14(7-12)15(16)19/h12-15,19H,2-11H2,1H3/t12-,13-,14?,15+,16?/m0/s1 |
| InChIKey | OARPTEVCRDPFQG-NEIABLLTSA-N |
| XLogP | 1.42 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |