C7H14N2O — CID 129453135
(3R,6R)-3-amino-6-methylazepan-2-one (PubChem CID 129453135) has the molecular formula C7H14N2O and a molecular weight of 142.20 g/mol. Its IUPAC name is (3R,6R)-3-amino-6-methylazepan-2-one.
| Compound Name | (3R,6R)-3-amino-6-methylazepan-2-one |
|---|---|
| PubChem CID | 129453135 |
| Molecular Formula | C7H14N2O |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.11 |
| IUPAC Name | (3R,6R)-3-amino-6-methylazepan-2-one |
| SMILES | C[C@@H]1CC[C@@H](N)C(=O)NC1 |
| InChI | InChI=1S/C7H14N2O/c1-5-2-3-6(8)7(10)9-4-5/h5-6H,2-4,8H2,1H3,(H,9,10)/t5-,6-/m1/s1 |
| InChIKey | USDDKKNPFIIEHD-PHDIDXHHSA-N |
| XLogP | -0.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |