C28H29N3O3 — CID 129454295
(6S)-10-(2-anilinobenzoyl)-4-phenyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one (PubChem CID 129454295) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is (6S)-10-(2-anilinobenzoyl)-4-phenyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one.
| Compound Name | (6S)-10-(2-anilinobenzoyl)-4-phenyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one |
|---|---|
| PubChem CID | 129454295 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | (6S)-10-(2-anilinobenzoyl)-4-phenyl-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one |
| SMILES | O=C(c1ccccc1Nc1ccccc1)N1CCC[C@]2(CC1)CN(c1ccccc1)C(=O)CO2 |
| InChI | InChI=1S/C28H29N3O3/c32-26-20-34-28(21-31(26)23-12-5-2-6-13-23)16-9-18-30(19-17-28)27(33)24-14-7-8-15-25(24)29-22-10-3-1-4-11-22/h1-8,10-15,29H,9,16-21H2/t28-/m0/s1 |
| InChIKey | DJSHSPYWFKVHQY-NDEPHWFRSA-N |
| XLogP | 4.86 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |