C28H32N4O3 — CID 129454791
2-[1-[4-(4-methylphenyl)oxane-4-carbonyl]piperidin-4-yl]-N-quinoxalin-6-ylacetamide (PubChem CID 129454791) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-[1-[4-(4-methylphenyl)oxane-4-carbonyl]piperidin-4-yl]-N-quinoxalin-6-ylacetamide.
| Compound Name | 2-[1-[4-(4-methylphenyl)oxane-4-carbonyl]piperidin-4-yl]-N-quinoxalin-6-ylacetamide |
|---|---|
| PubChem CID | 129454791 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 2-[1-[4-(4-methylphenyl)oxane-4-carbonyl]piperidin-4-yl]-N-quinoxalin-6-ylacetamide |
| SMILES | Cc1ccc(C2(C(=O)N3CCC(CC(=O)Nc4ccc5nccnc5c4)CC3)CCOCC2)cc1 |
| InChI | InChI=1S/C28H32N4O3/c1-20-2-4-22(5-3-20)28(10-16-35-17-11-28)27(34)32-14-8-21(9-15-32)18-26(33)31-23-6-7-24-25(19-23)30-13-12-29-24/h2-7,12-13,19,21H,8-11,14-18H2,1H3,(H,31,33) |
| InChIKey | GBOWOJVBTYUGGB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |