C26H33N3O5 — CID 129455963
1-[(2S)-2-(4-methoxyphenyl)-4-[2-(2-morpholin-4-ylethoxy)benzoyl]piperazin-1-yl]ethanone (PubChem CID 129455963) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is 1-[(2S)-2-(4-methoxyphenyl)-4-[2-(2-morpholin-4-ylethoxy)benzoyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[(2S)-2-(4-methoxyphenyl)-4-[2-(2-morpholin-4-ylethoxy)benzoyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 129455963 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 1-[(2S)-2-(4-methoxyphenyl)-4-[2-(2-morpholin-4-ylethoxy)benzoyl]piperazin-1-yl]ethanone |
| SMILES | COc1ccc([C@H]2CN(C(=O)c3ccccc3OCCN3CCOCC3)CCN2C(C)=O)cc1 |
| InChI | InChI=1S/C26H33N3O5/c1-20(30)29-12-11-28(19-24(29)21-7-9-22(32-2)10-8-21)26(31)23-5-3-4-6-25(23)34-18-15-27-13-16-33-17-14-27/h3-10,24H,11-19H2,1-2H3/t24-/m1/s1 |
| InChIKey | KCLIZDWGSNZVAX-XMMPIXPASA-N |
| XLogP | 2.45 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |