C26H34N4O3 — CID 129457530
2-[(1S,3aR,7aR)-3a-acetamido-2-methyl-1-phenyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]-N-(2-methoxy-5-methylphenyl)acetamide (PubChem CID 129457530) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is 2-[(1S,3aR,7aR)-3a-acetamido-2-methyl-1-phenyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]-N-(2-methoxy-5-methylphenyl)acetamide.
| Compound Name | 2-[(1S,3aR,7aR)-3a-acetamido-2-methyl-1-phenyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]-N-(2-methoxy-5-methylphenyl)acetamide |
|---|---|
| PubChem CID | 129457530 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 2-[(1S,3aR,7aR)-3a-acetamido-2-methyl-1-phenyl-1,3,4,6,7,7a-hexahydropyrrolo[3,4-c]pyridin-5-yl]-N-(2-methoxy-5-methylphenyl)acetamide |
| SMILES | COc1ccc(C)cc1NC(=O)CN1CC[C@@H]2[C@@H](c3ccccc3)N(C)C[C@]2(NC(C)=O)C1 |
| InChI | InChI=1S/C26H34N4O3/c1-18-10-11-23(33-4)22(14-18)27-24(32)15-30-13-12-21-25(20-8-6-5-7-9-20)29(3)16-26(21,17-30)28-19(2)31/h5-11,14,21,25H,12-13,15-17H2,1-4H3,(H,27,32)(H,28,31)/t21-,25-,26+/m1/s1 |
| InChIKey | PVRZDBDZBWKXIC-QGDZQMKYSA-N |
| XLogP | 2.83 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |