C27H25N5O3 — CID 129458305
[4-[3-(3-methylphenoxy)pyrazin-2-yl]piperidin-1-yl]-(3-pyrimidin-2-yloxyphenyl)methanone (PubChem CID 129458305) has the molecular formula C27H25N5O3 and a molecular weight of 467.53 g/mol. Its IUPAC name is [4-[3-(3-methylphenoxy)pyrazin-2-yl]piperidin-1-yl]-(3-pyrimidin-2-yloxyphenyl)methanone.
| Compound Name | [4-[3-(3-methylphenoxy)pyrazin-2-yl]piperidin-1-yl]-(3-pyrimidin-2-yloxyphenyl)methanone |
|---|---|
| PubChem CID | 129458305 |
| Molecular Formula | C27H25N5O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | [4-[3-(3-methylphenoxy)pyrazin-2-yl]piperidin-1-yl]-(3-pyrimidin-2-yloxyphenyl)methanone |
| SMILES | Cc1cccc(Oc2nccnc2C2CCN(C(=O)c3cccc(Oc4ncccn4)c3)CC2)c1 |
| InChI | InChI=1S/C27H25N5O3/c1-19-5-2-7-22(17-19)34-25-24(28-13-14-29-25)20-9-15-32(16-10-20)26(33)21-6-3-8-23(18-21)35-27-30-11-4-12-31-27/h2-8,11-14,17-18,20H,9-10,15-16H2,1H3 |
| InChIKey | SROUYJCFXDEYNS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 90.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |