C13H16O6 — CID 129459506
prop-2-enyl 5-[(2R,3R,4R)-3,4-dihydroxyoxolan-2-yl]-2-methylfuran-3-carboxylate (PubChem CID 129459506) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is prop-2-enyl 5-[(2R,3R,4R)-3,4-dihydroxyoxolan-2-yl]-2-methylfuran-3-carboxylate.
| Compound Name | prop-2-enyl 5-[(2R,3R,4R)-3,4-dihydroxyoxolan-2-yl]-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 129459506 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | prop-2-enyl 5-[(2R,3R,4R)-3,4-dihydroxyoxolan-2-yl]-2-methylfuran-3-carboxylate |
| SMILES | C=CCOC(=O)c1cc([C@@H]2OC[C@@H](O)[C@H]2O)oc1C |
| InChI | InChI=1S/C13H16O6/c1-3-4-17-13(16)8-5-10(19-7(8)2)12-11(15)9(14)6-18-12/h3,5,9,11-12,14-15H,1,4,6H2,2H3/t9-,11-,12+/m1/s1 |
| InChIKey | XRPGQWHTHKQYPJ-JLLWLGSASA-N |
| XLogP | 0.72 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|