C12H16N2O3 — CID 129460344
(3R,3aS,5S)-5-butyl-3-methyl-3a,7-dihydro-3H-pyrrolo[2,3-b]pyridine-2,4,6-trione (PubChem CID 129460344) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is (3R,3aS,5S)-5-butyl-3-methyl-3a,7-dihydro-3H-pyrrolo[2,3-b]pyridine-2,4,6-trione.
| Compound Name | (3R,3aS,5S)-5-butyl-3-methyl-3a,7-dihydro-3H-pyrrolo[2,3-b]pyridine-2,4,6-trione |
|---|---|
| PubChem CID | 129460344 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (3R,3aS,5S)-5-butyl-3-methyl-3a,7-dihydro-3H-pyrrolo[2,3-b]pyridine-2,4,6-trione |
| SMILES | CCCC[C@@H]1C(=O)NC2=NC(=O)[C@H](C)[C@@H]2C1=O |
| InChI | InChI=1S/C12H16N2O3/c1-3-4-5-7-9(15)8-6(2)11(16)13-10(8)14-12(7)17/h6-8H,3-5H2,1-2H3,(H,13,14,16,17)/t6-,7+,8-/m1/s1 |
| InChIKey | FYNNMPMUFJBCEZ-GJMOJQLCSA-N |
| XLogP | 0.68 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|