C16H26N2O3 — CID 129460914
tert-butyl N-[(3R)-1-[(1S)-1-(furan-2-yl)ethyl]piperidin-3-yl]carbamate (PubChem CID 129460914) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[(1S)-1-(furan-2-yl)ethyl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[(1S)-1-(furan-2-yl)ethyl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 129460914 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | tert-butyl N-[(3R)-1-[(1S)-1-(furan-2-yl)ethyl]piperidin-3-yl]carbamate |
| SMILES | C[C@@H](c1ccco1)N1CCC[C@@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C16H26N2O3/c1-12(14-8-6-10-20-14)18-9-5-7-13(11-18)17-15(19)21-16(2,3)4/h6,8,10,12-13H,5,7,9,11H2,1-4H3,(H,17,19)/t12-,13+/m0/s1 |
| InChIKey | YYHXWDNDDQKVGA-QWHCGFSZSA-N |
| XLogP | 3.33 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |