C15H15F3I2O2 — CID 129460987
2-[(1S,2S,3S,5S,6R,7S,8R,9S,10S,11R)-7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]ethyl 2,2,2-trifluoroacetate (PubChem CID 129460987) has the molecular formula C15H15F3I2O2 and a molecular weight of 538.09 g/mol. Its IUPAC name is 2-[(1S,2S,3S,5S,6R,7S,8R,9S,10S,11R)-7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]ethyl 2,2,2-trifluoroacetate.
| Compound Name | 2-[(1S,2S,3S,5S,6R,7S,8R,9S,10S,11R)-7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]ethyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 129460987 |
| Molecular Formula | C15H15F3I2O2 |
| Molecular Weight | 538.09 g/mol |
| Exact Mass | 537.91 |
| IUPAC Name | 2-[(1S,2S,3S,5S,6R,7S,8R,9S,10S,11R)-7,11-diiodo-1-pentacyclo[6.3.0.02,6.03,10.05,9]undecanyl]ethyl 2,2,2-trifluoroacetate |
| SMILES | O=C(OCC[C@]12[C@@H]3[C@@H](I)[C@@H]4[C@H]5C[C@H]([C@@H]([C@H]53)[C@H]1I)[C@@H]42)C(F)(F)F |
| InChI | InChI=1S/C15H15F3I2O2/c16-15(17,18)13(21)22-2-1-14-9-5-3-4-6(7(5)12(14)20)10(14)11(19)8(4)9/h4-12H,1-3H2/t4-,5+,6-,7-,8+,9-,10-,11-,12+,14-/m0/s1 |
| InChIKey | OXVNOXDFMIGYPX-ATJANYJXSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.09 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|