(2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid

C8H13F2NO2 — CID 129463029

IUPAC(2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid
SMILESC[C@H](C(=O)O)N1CCC(F)(F)CC1
InChIInChI=1S/C8H13F2NO2/c1-6(7(12)13)11-4-2-8(9,10)3-5-11/h6H,2-5H2,1H3,(H,12,13)/t6-/m1/s1
InChIKeyIORWBGTYNXHCAR-ZCFIWIBFSA-N
MW193.19 g/mol
LogP1.19
Rot. Bonds2

About (2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid

(2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid (PubChem CID 129463029) has the molecular formula C8H13F2NO2 and a molecular weight of 193.19 g/mol. Its IUPAC name is (2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid.

Molecular Properties

Compound Name(2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid
PubChem CID129463029
Molecular FormulaC8H13F2NO2
Molecular Weight193.19 g/mol
Exact Mass193.09
IUPAC Name(2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid
SMILESC[C@H](C(=O)O)N1CCC(F)(F)CC1
InChIInChI=1S/C8H13F2NO2/c1-6(7(12)13)11-4-2-8(9,10)3-5-11/h6H,2-5H2,1H3,(H,12,13)/t6-/m1/s1
InChIKeyIORWBGTYNXHCAR-ZCFIWIBFSA-N
XLogP1.19
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500193.19
LogP ≤ 51.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid?
The IUPAC name of (2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid (CID 129463029) is (2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid.
What is the SMILES notation for (2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid?
The canonical SMILES for (2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid is C[C@H](C(=O)O)N1CCC(F)(F)CC1.
What is the InChIKey of (2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid?
The InChIKey is IORWBGTYNXHCAR-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H13F2NO2/c1-6(7(12)13)11-4-2-8(9,10)3-5-11/h6H,2-5H2,1H3,(H,12,13)/t6-/m1/s1.
What are the key properties of (2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid?
(2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid has a molecular weight of 193.19 g/mol, XLogP of 1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(4,4-difluoropiperidin-1-yl)propanoic acid is sourced from PubChem (CID 129463029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).