About methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate
methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate (PubChem CID 129463418) has the molecular formula C17H25NO3
and a molecular weight of 291.39 g/mol. Its IUPAC name is methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate.
Molecular Properties
| Compound Name | methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate |
| PubChem CID | 129463418 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate |
| SMILES | COC(=O)CCN(C)[C@@H]1CCCC[C@H]1Oc1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-18(13-12-17(19)20-2)15-10-6-7-11-16(15)21-14-8-4-3-5-9-14/h3-5,8-9,15-16H,6-7,10-13H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | NSPIHLJDVJDQKM-HZPDHXFCSA-N |
| XLogP | 2.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate?
The IUPAC name of methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate (CID 129463418) is methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate.
What is the SMILES notation for methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate?
The canonical SMILES for methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate is COC(=O)CCN(C)[C@@H]1CCCC[C@H]1Oc1ccccc1.
What is the InChIKey of methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate?
The InChIKey is NSPIHLJDVJDQKM-HZPDHXFCSA-N. The full InChI is InChI=1S/C17H25NO3/c1-18(13-12-17(19)20-2)15-10-6-7-11-16(15)21-14-8-4-3-5-9-14/h3-5,8-9,15-16H,6-7,10-13H2,1-2H3/t15-,16-/m1/s1.
What are the key properties of methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate?
methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate has a molecular weight of 291.39 g/mol, XLogP of 2.87, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[methyl-[(1R,2R)-2-phenoxycyclohexyl]amino]propanoate is sourced from PubChem (CID 129463418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).