C8H11NO — CID 12946558
5,6,7,8-tetrahydro-4H-furo[3,2-c]azepine (PubChem CID 12946558) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-4H-furo[3,2-c]azepine.
| Compound Name | 5,6,7,8-tetrahydro-4H-furo[3,2-c]azepine |
|---|---|
| PubChem CID | 12946558 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 5,6,7,8-tetrahydro-4H-furo[3,2-c]azepine |
| SMILES | c1cc2c(o1)CCCNC2 |
| InChI | InChI=1S/C8H11NO/c1-2-8-7(3-5-10-8)6-9-4-1/h3,5,9H,1-2,4,6H2 |
| InChIKey | INHBEZLAWKRIEI-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |