C17H22N4O2 — CID 129466083
(3S)-3-(methoxymethyl)-N-[(2-pyrazol-1-ylphenyl)methyl]pyrrolidine-3-carboxamide (PubChem CID 129466083) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is (3S)-3-(methoxymethyl)-N-[(2-pyrazol-1-ylphenyl)methyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-3-(methoxymethyl)-N-[(2-pyrazol-1-ylphenyl)methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 129466083 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | (3S)-3-(methoxymethyl)-N-[(2-pyrazol-1-ylphenyl)methyl]pyrrolidine-3-carboxamide |
| SMILES | COC[C@]1(C(=O)NCc2ccccc2-n2cccn2)CCNC1 |
| InChI | InChI=1S/C17H22N4O2/c1-23-13-17(7-9-18-12-17)16(22)19-11-14-5-2-3-6-15(14)21-10-4-8-20-21/h2-6,8,10,18H,7,9,11-13H2,1H3,(H,19,22)/t17-/m0/s1 |
| InChIKey | IUPPXOXLHBLICD-KRWDZBQOSA-N |
| XLogP | 1.11 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |