About 8-methoxynaphtho[2,3-b][1]benzothiole
8-methoxynaphtho[2,3-b][1]benzothiole (PubChem CID 12946621) has the molecular formula C17H12OS
and a molecular weight of 264.35 g/mol. Its IUPAC name is 8-methoxynaphtho[2,3-b][1]benzothiole.
Molecular Properties
| Compound Name | 8-methoxynaphtho[2,3-b][1]benzothiole |
| PubChem CID | 12946621 |
| Molecular Formula | C17H12OS |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 8-methoxynaphtho[2,3-b][1]benzothiole |
| SMILES | COc1ccc2cc3c(cc2c1)sc1ccccc13 |
| InChI | InChI=1S/C17H12OS/c1-18-13-7-6-11-9-15-14-4-2-3-5-16(14)19-17(15)10-12(11)8-13/h2-10H,1H3 |
| InChIKey | PZFHMBXHWBGABF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-methoxynaphtho[2,3-b][1]benzothiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxynaphtho[2,3-b][1]benzothiole?
The IUPAC name of 8-methoxynaphtho[2,3-b][1]benzothiole (CID 12946621) is 8-methoxynaphtho[2,3-b][1]benzothiole.
What is the SMILES notation for 8-methoxynaphtho[2,3-b][1]benzothiole?
The canonical SMILES for 8-methoxynaphtho[2,3-b][1]benzothiole is COc1ccc2cc3c(cc2c1)sc1ccccc13.
What is the InChIKey of 8-methoxynaphtho[2,3-b][1]benzothiole?
The InChIKey is PZFHMBXHWBGABF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12OS/c1-18-13-7-6-11-9-15-14-4-2-3-5-16(14)19-17(15)10-12(11)8-13/h2-10H,1H3.
What are the key properties of 8-methoxynaphtho[2,3-b][1]benzothiole?
8-methoxynaphtho[2,3-b][1]benzothiole has a molecular weight of 264.35 g/mol, XLogP of 5.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxynaphtho[2,3-b][1]benzothiole is sourced from PubChem (CID 12946621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).